CymitQuimica logo

CAS 121071-92-9

:

6-(1H-indol-3-ylmethyl)-5-methoxy-3-(2-methylpropyl)pyrazin-2(1H)-one 4-oxide

Description:
6-(1H-indol-3-ylmethyl)-5-methoxy-3-(2-methylpropyl)pyrazin-2(1H)-one 4-oxide, with the CAS number 121071-92-9, is a synthetic organic compound characterized by its complex molecular structure, which includes an indole moiety, a pyrazinone core, and a methoxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and pharmacology. The presence of the indole ring suggests possible interactions with biological targets, as indoles are known for their diverse biological activities. Additionally, the pyrazinone structure may contribute to its stability and reactivity. The compound's unique functional groups may influence its chemical reactivity, including potential oxidation states and interactions with other molecules. Overall, this compound represents a class of heterocyclic compounds that may have applications in drug development or as research tools in biochemical studies. Further investigation into its specific properties and biological activities would be necessary to fully understand its potential applications.
Formula:C18H21N3O3
InChI:InChI=1/C18H21N3O3/c1-11(2)8-16-17(22)20-15(18(24-3)21(16)23)9-12-10-19-14-7-5-4-6-13(12)14/h4-7,10-11,19H,8-9H2,1-3H3,(H,20,22)
Synonyms:
  • 2(1H)-Pyrazinone, 6-(1H-indol-3-ylmethyl)-5-methoxy-3-(2-methylpropyl)-, 4-oxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.