
CAS 1210824-86-4
:4-Piperidinone, 1-cyclobutyl-, hydrochloride (1:1)
Description:
4-Piperidinone, 1-cyclobutyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidinone structure, which features a six-membered ring containing nitrogen and a carbonyl group. The presence of a cyclobutyl group indicates that a four-membered carbon ring is attached to the piperidinone, influencing its steric and electronic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The compound may exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to form salts with acids. Its potential applications could include use as an intermediate in organic synthesis or in the development of biologically active compounds. Safety and handling precautions should be observed, as with any chemical substance, due to the potential for toxicity or reactivity. Further characterization, including spectral analysis, would provide more detailed insights into its structure and properties.
Formula:C9H15NO·ClH
InChI:InChI=1S/C9H15NO.ClH/c11-9-4-6-10(7-5-9)8-2-1-3-8;/h8H,1-7H2;1H
InChI key:InChIKey=UYXWGPWDWWSIPU-UHFFFAOYSA-N
SMILES:O=C1CCN(C2CCC2)CC1.Cl
Synonyms:- 4-Piperidinone, 1-cyclobutyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
