CAS 1210824-90-0

4,5-Dihydro-2-(1-methylethyl)-4-oxazolecarboxylic acid

Description:

4,5-Dihydro-2-(1-methylethyl)-4-oxazolecarboxylic acid is a chemical compound characterized by its oxazole ring structure, which contributes to its unique reactivity and properties. This compound features a five-membered heterocyclic ring containing both nitrogen and oxygen, which can influence its solubility and interaction with biological systems. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, potentially affecting its bioavailability and pharmacokinetics. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound may exhibit specific biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, although specific biological or chemical activities would require further investigation. Overall, 4,5-Dihydro-2-(1-methylethyl)-4-oxazolecarboxylic acid represents a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₇H₁₁NO₃

InChI: InChI=1S/C7H11NO3/c1-4(2)6-8-5(3-11-6)7(9)10/h4-5H,3H2,1-2H3,(H,9,10)

InChI key: InChIKey=VAJPROOEDQJSQS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1N=C(C(C)C)OC1

Synonyms:

• 4,5-Dihydro-2-(1-methylethyl)-4-oxazolecarboxylic acid
• 4-Oxazolecarboxylic acid, 4,5-dihydro-2-(1-methylethyl)-