CAS 121091-31-4: 1H-Imidazolium, 1,3-dimethyl-, tetrafluoroborate(1-) (1:1)
Description:1H-Imidazolium, 1,3-dimethyl-, tetrafluoroborate(1-) (1:1), commonly referred to as DMIM·BF4, is an ionic liquid that features a 1,3-dimethylimidazolium cation paired with a tetrafluoroborate anion. This compound is characterized by its low viscosity, high thermal stability, and relatively low volatility, making it suitable for various applications in organic synthesis and electrochemistry. The imidazolium cation contributes to its ability to dissolve a wide range of polar and nonpolar compounds, enhancing its utility as a solvent. Additionally, the tetrafluoroborate anion imparts certain ionic properties that can influence the compound's conductivity and reactivity. DMIM·BF4 is often used in catalysis, as an electrolyte in batteries, and in the development of green chemistry processes due to its favorable environmental profile. Its unique properties stem from the combination of the imidazolium structure and the tetrafluoroborate anion, which together create a versatile and effective chemical substance in various scientific and industrial applications.
Formula:C5H9N2·BF4
InChI:InChI=1S/C5H9N2.BF4/c1-6-3-4-7(2)5-6;2-1(3,4)5/h3-5H,1-2H3;/q+1;-1
InChI key:InChIKey=FBPIPPWLOCMHGR-UHFFFAOYSA-N
SMILES:[F-][B+3]([F-])([F-])[F-].C1=C[N+](=CN1C)C
- Synonyms:
- 1H-Imidazolium, 1,3-dimethyl-, tetrafluoroborate(1-)
- DMIM-BF4
- 1,3-Dimethylimidazolium tetrafluoroborate
- 1-Methyl-3-methylimidazolium tetrafluoroborate
- 1H-Imidazolium, 1,3-dimethyl-, tetrafluoroborate(1-) (1:1)