CymitQuimica logo

CAS 1210935-33-3

:

[(3R)-1-methylpyrrolidin-3-yl]methanol

Description:
[(3R)-1-methylpyrrolidin-3-yl]methanol is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The compound features a methyl group attached to the nitrogen atom of the pyrrolidine ring and a hydroxymethyl group (-CH2OH) linked to the carbon adjacent to the nitrogen. This configuration imparts specific stereochemical properties, as indicated by the (3R) designation, which refers to the spatial arrangement of the atoms around the chiral center. The presence of the hydroxymethyl group suggests that the compound may exhibit polar characteristics, potentially making it soluble in polar solvents. Additionally, the nitrogen atom in the pyrrolidine ring can participate in hydrogen bonding, influencing the compound's reactivity and interactions with other molecules. Such compounds are often of interest in medicinal chemistry due to their potential biological activities, including effects on neurotransmitter systems. Overall, [(3R)-1-methylpyrrolidin-3-yl]methanol is a versatile compound with implications in various chemical and pharmaceutical applications.
Formula:C6H13NO
InChI:InChI=1S/C6H13NO/c1-7-3-2-6(4-7)5-8/h6,8H,2-5H2,1H3/t6-/m1/s1
InChI key:NPWMWLAPRVMNBN-ZCFIWIBFSA-N
SMILES:CN1CC[C@H](C1)CO
Found 6 products.