CymitQuimica logo

CAS 1211-06-9

:

5,11-dihydro-6H-dibenzo[b,e]azepin-6-one

Description:
5,11-Dihydro-6H-dibenzo[b,e]azepin-6-one, with the CAS number 1211-06-9, is a heterocyclic organic compound characterized by its fused dibenzo and azepine structures. This compound features a bicyclic system that includes a seven-membered nitrogen-containing ring, contributing to its unique chemical properties. It typically exhibits a solid state at room temperature and is known for its potential biological activity, which has been explored in various pharmacological contexts. The presence of the carbonyl group (ketone) in its structure can influence its reactivity and interactions with other molecules. Additionally, the compound may exhibit moderate solubility in organic solvents, while its solubility in water is generally limited. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of psychoactive or therapeutic agents. As with many organic compounds, safety and handling precautions should be observed, as its biological effects and toxicity profiles may vary.
Formula:C14H11NO
InChI:InChI=1/C14H11NO/c16-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15-14/h1-8H,9H2,(H,15,16)
SMILES:c1ccc2c(c1)Cc1ccccc1N=C2O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.