CAS 1211-09-2
:2-chlorophenazine 5-oxide
Description:
2-Chlorophenazine 5-oxide, with the CAS number 1211-09-2, is a chemical compound that belongs to the phenazine family, characterized by a bicyclic structure containing two fused aromatic rings. This compound features a chlorine substituent at the 2-position and an oxide group at the 5-position of the phenazine ring system. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific form. 2-Chlorophenazine 5-oxide is known for its potential applications in various fields, including organic synthesis and as a reagent in chemical reactions. Its properties include moderate solubility in organic solvents and limited solubility in water, which is common for many phenazine derivatives. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many chemical substances, handling should be done with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this compound in laboratory settings.
Formula:C12H7ClN2O
InChI:InChI=1/C12H7ClN2O/c13-8-5-6-12-10(7-8)14-9-3-1-2-4-11(9)15(12)16/h1-7H
SMILES:c1ccc2c(c1)nc1cc(ccc1n2=O)Cl
Synonyms:- Phenazine, 2-chloro-, 5-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.