CAS 1211-35-4
:2-(4-chlorophenyl)-1H-indole
Description:
2-(4-Chlorophenyl)-1H-indole, with the CAS number 1211-35-4, is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a 4-chlorophenyl group at the second position of the indole ring significantly influences its chemical properties and reactivity. This compound typically exhibits a solid state at room temperature and is known for its potential biological activities, including antimicrobial and anticancer properties. Its molecular structure allows for various interactions, making it a subject of interest in medicinal chemistry and drug development. The compound is generally soluble in organic solvents, but its solubility in water is limited. Additionally, it may undergo various chemical reactions, such as electrophilic substitution, due to the presence of the electron-rich indole moiety. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly. Overall, 2-(4-chlorophenyl)-1H-indole is a valuable compound in research and pharmaceutical applications.
Formula:C14H10ClN
InChI:InChI=1/C14H10ClN/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9,16H
SMILES:c1ccc2c(c1)cc(c1ccc(cc1)Cl)[nH]2
Synonyms:- 2-(4-Chlorophenyl)indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(4-Chlorophenyl)indole, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C14H10ClNPurity:98%Color and Shape:Cream, PowderMolecular weight:227.692-(4-Chlorophenyl)-1H-indole
CAS:Formula:C14H10ClNPurity:98%Color and Shape:SolidMolecular weight:227.68892-(4-Chlorophenyl)-1H-indole
CAS:2-(4-Chlorophenyl)-1H-indoleFormula:C14H10ClNPurity:≥95%Color and Shape: faint yellow powderMolecular weight:227.69g/mol2-(4-Chlorophenyl)-1H-indole
CAS:Formula:C14H10ClNPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:227.692-(4-Chlorophenyl)-1H-indole
CAS:Purity:95.0%Color and Shape:Liquid, No data available.Molecular weight:227.69000244140625




