CAS 121105-77-9

2-FORMYL-3-METHYL-1-OXO-1,5-DIHYDRO-BENZO[4,5]IMIDAZO[1,2-A]PYRIDINE-4-CARBONITRILE

Description:

2-Formyl-3-methyl-1-oxo-1,5-dihydro-benzo[4,5]imidazo[1,2-a]pyridine-4-carbonitrile, with the CAS number 121105-77-9, is a complex organic compound characterized by its unique bicyclic structure that incorporates both imidazole and pyridine moieties. This compound features a formyl group (-CHO) and a carbonitrile group (-CN), which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carbonyl group (C=O) indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the methyl group attached to the benzene ring can influence the compound's electronic properties and steric hindrance. Its structural complexity suggests potential biological activity, making it a candidate for further investigation in drug development or as a building block in the synthesis of more complex molecules. However, specific physical properties such as solubility, melting point, and stability would require empirical measurement or literature reference for detailed characterization.

Formula: C₁₄H₉N₃O₂

InChI: InChI=1/C14H9N3O2/c1-8-9(6-15)13-16-11-4-2-3-5-12(11)17(13)14(19)10(8)7-18/h2-5,7,16H,1H3

SMILES: Cc1c(C#N)c2[nH]c3ccccc3n2c(=O)c1C=O

Synonyms:

• Pyrido[1,2-a]benzimidazole-4-carbonitrile, 2-formyl-1,5-dihydro-3-methyl-1-oxo-
• 2-Formyl-3-Methyl-1-Oxo-1,5-Dihydropyrido[1,2-A]Benzimidazole-4-Carbonitrile

2-Formyl-3-methyl-1-oxo-1,5-dihydropyrido[1,2-a]benzimidazole-4-carbonitrile

CAS: 121105-77-9

Versatile small molecule scaffold

Formula: C₁₄H₉N₃O₂

Purity: Min. 95%

Molecular weight: 251.24 g/mol

Ref: 3D-WEA10577