CAS 121123-45-3

2-(Acetylamino)-2-deoxy-3,4,6-tris-O-(phenylmethyl)-α-D-glucopyranose

Description:

2-(Acetylamino)-2-deoxy-3,4,6-tris-O-(phenylmethyl)-α-D-glucopyranose is a complex carbohydrate derivative, specifically a glycoside, that features a glucopyranose backbone modified with an acetylamino group and multiple phenylmethyl (benzyl) protecting groups. This compound is characterized by its structural stability and solubility in organic solvents, which is influenced by the presence of the bulky phenylmethyl groups. The acetylamino group introduces a functional site that can participate in further chemical reactions, making it a versatile intermediate in synthetic organic chemistry. Its α-D-glucopyranose configuration suggests that it adopts a specific anomeric form, which can affect its reactivity and interactions with biological systems. The compound's molecular structure contributes to its potential applications in medicinal chemistry, particularly in the design of glycosylated drugs or as a building block for more complex carbohydrate structures. Additionally, its unique properties may allow for selective interactions with enzymes or receptors, highlighting its relevance in biochemical research.

Formula: C₂₉H₃₃NO₆

InChI: InChI=1S/C29H33NO6/c1-21(31)30-26-28(35-19-24-15-9-4-10-16-24)27(34-18-23-13-7-3-8-14-23)25(36-29(26)32)20-33-17-22-11-5-2-6-12-22/h2-16,25-29,32H,17-20H2,1H3,(H,30,31)/t25-,26-,27-,28-,29+/m1/s1

InChI key: InChIKey=BMOPHWKYXVHVMF-JPHCZMGXSA-N

SMILES: O(CC1=CC=CC=C1)[C@H]2[C@H](OCC3=CC=CC=C3)[C@@H](COCC4=CC=CC=C4)O[C@H](O)[C@@H]2NC(C)=O

Synonyms:

• 2-(Acetylamino)-2-deoxy-3,4,6-tris-O-(phenylmethyl)-α-D-glucopyranose
• α-D-Glucopyranose, 2-(acetylamino)-2-deoxy-3,4,6-tris-O-(phenylmethyl)-

2-Acetamido-3,4,6-tri-O-benzyl-2-deoxy-D-glucose

CAS: 121123-45-3

2-Acetamido-3,4,6-tri-O-benzyl-2-deoxy-D-glucose is a high quality chemical that can be used as a scaffold for the synthesis of complex compounds. It is also an intermediate in the synthesis of reagents and fine chemicals. 2-Acetamido-3,4,6-tri-O-benzyl-2-deoxyglucose has been shown to be useful in the synthesis of speciality chemicals and research chemicals. This compound is versatile because it can be used as a building block for reactions that are sensitive to water or air.

Formula: C₂₉H₃₃NO₆

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 491.58 g/mol

Ref: 3D-MA181600