CAS 121124-97-8
:3-Formyl-4-methoxybenzeneboronic acid
Description:
3-Formyl-4-methoxybenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its reactivity in various organic transformations, particularly in Suzuki coupling reactions. This compound features a formyl group (-CHO) and a methoxy group (-OCH3) attached to a benzene ring, contributing to its unique chemical properties. The presence of the boronic acid moiety allows for the formation of stable complexes with diols, making it useful in the synthesis of complex organic molecules. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially enhancing its reactivity or solubility in organic solvents. 3-Formyl-4-methoxybenzeneboronic acid is typically utilized in organic synthesis, medicinal chemistry, and materials science, where its ability to participate in cross-coupling reactions is particularly valuable. Its structural features and reactivity make it a versatile building block in the development of pharmaceuticals and advanced materials.
Formula:C8H9BO4
InChI:InChI=1/C8H9BO4/c1-13-8-3-2-7(9(11)12)4-6(8)5-10/h2-5,11-12H,1H3
SMILES:COc1ccc(cc1C=O)B(O)O
Synonyms:- 5-Borono-o-anisaldehyde~5-Borono-2-methoxybenzaldehyde~3-Formyl-4-methoxyphenylboronic acid
- (3-Formyl-4-methoxyphenyl)boronic acid
- 3-Formyl-4-methoxyphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Formyl-4-methoxybenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H9BO4Purity:98%Color and Shape:White to cream, PowderMolecular weight:179.973-Formyl-4-methoxyphenylboronic acid
CAS:Formula:C8H9BO4Purity:98%Color and Shape:SolidMolecular weight:179.96573-Formyl-4-methoxybenzeneboronic acid
CAS:3-Formyl-4-methoxybenzeneboronic acidPurity:98%Color and Shape:Off-White PowderMolecular weight:179.97g/mol3-Formyl-4-methoxyphenylboronic acid
CAS:Formula:C8H9BO4Purity:98%Color and Shape:Solid, Off-white powderMolecular weight:179.97



