CAS 121124-97-8

3-Formyl-4-methoxybenzeneboronic acid

Description:

3-Formyl-4-methoxybenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its reactivity in various organic transformations, particularly in Suzuki coupling reactions. This compound features a formyl group (-CHO) and a methoxy group (-OCH3) attached to a benzene ring, contributing to its unique chemical properties. The presence of the boronic acid moiety allows for the formation of stable complexes with diols, making it useful in the synthesis of complex organic molecules. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially enhancing its reactivity or solubility in organic solvents. 3-Formyl-4-methoxybenzeneboronic acid is typically utilized in organic synthesis, medicinal chemistry, and materials science, where its ability to participate in cross-coupling reactions is particularly valuable. Its structural features and reactivity make it a versatile building block in the development of pharmaceuticals and advanced materials.

Formula: C₈H₉BO₄

InChI: InChI=1/C8H9BO4/c1-13-8-3-2-7(9(11)12)4-6(8)5-10/h2-5,11-12H,1H3

SMILES: COc1ccc(cc1C=O)B(O)O

Synonyms:

• 5-Borono-o-anisaldehyde~5-Borono-2-methoxybenzaldehyde~3-Formyl-4-methoxyphenylboronic acid
• (3-Formyl-4-methoxyphenyl)boronic acid
• 3-Formyl-4-methoxyphenylboronic acid

3-Formyl-4-methoxybenzeneboronic acid, 98%

CAS: 121124-97-8

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₈H₉BO₄

Purity: 98%

Color and Shape: White to cream, Powder

Molecular weight: 179.97

Ref: 02-L17850

3-Formyl-4-methoxyphenylboronic acid

CAS: 121124-97-8

Formula: C₈H₉BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.9657

Ref: IN-DA0037VV

3-Formyl-4-methoxybenzeneboronic acid

CAS: 121124-97-8

3-Formyl-4-methoxybenzeneboronic acid

Purity: 98%

Color and Shape: Off-White Powder

Molecular weight: 179.97g/mol

Ref: 54-OR7215

3-Formyl-4-methoxyphenylboronic acid

CAS: 121124-97-8

Formula: C₈H₉BO₄

Purity: 98%

Color and Shape: Solid, Off-white powder

Molecular weight: 179.97

Ref: 10-F021614