CAS 1211298-93-9
:N-[2-Chloro-5-(trifluoromethyl)phenyl]-N′-[[2-(4-morpholinyl)-3-pyridinyl]methyl]urea
Description:
N-[2-Chloro-5-(trifluoromethyl)phenyl]-N′-[[2-(4-morpholinyl)-3-pyridinyl]methyl]urea, with CAS number 1211298-93-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a urea functional group. This compound features a chloro-substituted phenyl ring and a trifluoromethyl group, contributing to its unique chemical properties and potential biological activity. The presence of a morpholine and pyridine moiety suggests that it may exhibit interactions with biological targets, making it of interest in medicinal chemistry. Its molecular design indicates potential applications in pharmaceuticals, particularly in the development of therapeutic agents. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular architecture. As with many synthetic compounds, safety and handling precautions are essential, given the presence of halogenated groups, which can influence toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C18H18ClF3N4O2
InChI:InChI=1S/C18H18ClF3N4O2/c19-14-4-3-13(18(20,21)22)10-15(14)25-17(27)24-11-12-2-1-5-23-16(12)26-6-8-28-9-7-26/h1-5,10H,6-9,11H2,(H2,24,25,27)
InChI key:InChIKey=JJHCGBJJVJDFIZ-UHFFFAOYSA-N
SMILES:C(NC(NC1=CC(C(F)(F)F)=CC=C1Cl)=O)C2=C(N=CC=C2)N3CCOCC3
Synonyms:- Urea, N-[2-chloro-5-(trifluoromethyl)phenyl]-N′-[[2-(4-morpholinyl)-3-pyridinyl]methyl]-
- N-[2-Chloro-5-(trifluoromethyl)phenyl]-N′-[[2-(4-morpholinyl)-3-pyridinyl]methyl]urea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[2-(4-morpholinyl)-3-pyridinyl]methyl]-Urea
CAS:Controlled ProductFormula:C18H18ClF3N4O2Color and Shape:NeatMolecular weight:414.809
