CAS 1211431-83-2

Ethanone, 1-[2-(aminomethyl)-4-morpholinyl]-, hydrochloride (1:1)

Description:

Ethanone, 1-[2-(aminomethyl)-4-morpholinyl]-, hydrochloride (1:1), also known by its CAS number 1211431-83-2, is a chemical compound characterized by its morpholine structure, which includes a morpholine ring substituted with an aminomethyl group. This compound typically appears as a hydrochloride salt, indicating it is a protonated form that enhances its solubility in water. The presence of the morpholine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The aminomethyl group may contribute to its reactivity and biological activity, making it a candidate for further investigation in drug design. Additionally, the hydrochloride form often improves stability and handling properties. As with many organic compounds, safety data should be consulted to understand its toxicity, handling precautions, and environmental impact. Overall, this compound's unique structure and properties make it of interest in various chemical and pharmaceutical research contexts.

Formula: C₇H₁₄N₂O₂·ClH

InChI: InChI=1S/C7H14N2O2.ClH/c1-6(10)9-2-3-11-7(4-8)5-9;/h7H,2-5,8H2,1H3;1H

InChI key: InChIKey=WSTCCYVQUUFSNV-UHFFFAOYSA-N

SMILES: C(C)(=O)N1CC(CN)OCC1.Cl

Synonyms:

• Ethanone, 1-[2-(aminomethyl)-4-morpholinyl]-, hydrochloride (1:1)