CAS 1211483-87-2

Benzoic acid, 3,3′-(1,5-tricyclo[3.3.1.13,7]decanediyl)bis[6-methoxy-

Description:

Benzoic acid, 3,3′-(1,5-tricyclo[3.3.1.13,7]decanediyl)bis[6-methoxy-] is a complex organic compound characterized by its unique structural features, which include a benzoic acid moiety and a tricyclic framework. The presence of methoxy groups enhances its solubility and reactivity, making it of interest in various chemical applications. This compound is likely to exhibit typical benzoic acid properties, such as being a weak acid, capable of forming salts and esters. Its tricyclic structure may impart additional stability and influence its physical properties, such as melting and boiling points, as well as its solubility in different solvents. The compound's unique arrangement of functional groups can also affect its biological activity, making it a candidate for research in medicinal chemistry. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical behavior, which is crucial for its potential applications in pharmaceuticals and materials science.

Formula: C₂₆H₂₈O₆

InChI: InChI=1S/C26H28O6/c1-31-21-5-3-17(8-19(21)23(27)28)25-10-15-7-16(11-25)13-26(12-15,14-25)18-4-6-22(32-2)20(9-18)24(29)30/h3-6,8-9,15-16H,7,10-14H2,1-2H3,(H,27,28)(H,29,30)

InChI key: InChIKey=XPTSMFCEEHQEPG-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C23CC4(CC(C2)CC(C3)C4)C5=CC(C(O)=O)=C(OC)C=C5)C=CC1OC

Synonyms:

• 5-[3-(3-Carboxy-4-methoxyphenyl)adamantanyl]-2-methoxybenzoic acid
• Benzoic acid, 3,3′-(1,5-tricyclo[3.3.1.13,7]decanediyl)bis[6-methoxy-