CAS 1211495-35-0

Benzenamine, 2-(2-fluorophenoxy)-, hydrochloride (1:1)

Description:

Benzenamine, 2-(2-fluorophenoxy)-, hydrochloride (1:1), also known by its CAS number 1211495-35-0, is a chemical compound characterized by its amine functional group and the presence of a fluorophenoxy moiety. This substance typically appears as a white to off-white solid and is soluble in water due to the hydrochloride salt form, which enhances its solubility compared to the free base. The compound exhibits properties associated with both aromatic amines and ether functionalities, which may influence its reactivity and potential applications in pharmaceuticals or agrochemicals. Its structure suggests potential biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as aromatic amines can pose health risks, including potential carcinogenicity. Proper handling and storage conditions are essential to ensure safety and stability. As with any chemical, it is crucial to refer to specific material safety data sheets (MSDS) and regulatory guidelines for comprehensive information on hazards and safe usage.

Formula: C₁₂H₁₀FNO·ClH

InChI: InChI=1S/C12H10FNO.ClH/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14;/h1-8H,14H2;1H

InChI key: InChIKey=DJDHZVLZUDWDKU-UHFFFAOYSA-N

SMILES: O(C1=C(F)C=CC=C1)C2=C(N)C=CC=C2.Cl

Synonyms:

• Benzenamine, 2-(2-fluorophenoxy)-, hydrochloride (1:1)

[2-(2-fluorophenoxy)phenyl]amine hydrochloride

CAS: 1211495-35-0

Formula: C₁₂H₁₁ClFNO

Purity: 95.0%

Molecular weight: 239.67

Ref: 10-F359045