CAS 1211495-57-6

Benzoxazole, 2-[(4-piperidinylmethyl)thio]-, hydrochloride (1:1)

Description:

Benzoxazole, 2-[(4-piperidinylmethyl)thio]-, hydrochloride (1:1) is a chemical compound characterized by its benzoxazole core, which is a bicyclic structure containing both benzene and oxazole rings. The presence of a piperidinylmethylthio group enhances its potential biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in pharmaceutical formulations. The compound may exhibit various pharmacological properties, potentially acting as an antagonist or modulator in biological systems. Its molecular structure suggests it could interact with specific receptors or enzymes, contributing to its therapeutic effects. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a class of heterocyclic compounds that are often explored for their utility in drug development and other applications in organic synthesis.

Formula: C₁₃H₁₆N₂OS·ClH

InChI: InChI=1S/C13H16N2OS.ClH/c1-2-4-12-11(3-1)15-13(16-12)17-9-10-5-7-14-8-6-10;/h1-4,10,14H,5-9H2;1H

InChI key: InChIKey=DNWQVRVDIONXKA-UHFFFAOYSA-N

SMILES: S(CC1CCNCC1)C2=NC=3C(O2)=CC=CC3.Cl

Synonyms:

• Benzoxazole, 2-[(4-piperidinylmethyl)thio]-, hydrochloride (1:1)