CAS 1211511-24-8

4-(4-Fluorophenyl)-2-thiazolemethanol

Description:

4-(4-Fluorophenyl)-2-thiazolemethanol is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, enhancing the compound's potential for biological activity and influencing its physicochemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. The thiazole moiety often contributes to the compound's reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the hydroxymethyl group (-CH2OH) suggests potential for hydrogen bonding, which can affect its pharmacokinetics and binding affinity in biological systems. Overall, 4-(4-Fluorophenyl)-2-thiazolemethanol is a compound of interest for research, particularly in the fields of pharmaceuticals and agrochemicals, where its unique structural features may confer specific biological activities.

Formula: C₁₀H₈FNOS

InChI: InChI=1S/C10H8FNOS/c11-8-3-1-7(2-4-8)9-6-14-10(5-13)12-9/h1-4,6,13H,5H2

InChI key: InChIKey=SDZNQPGOGCLEII-UHFFFAOYSA-N

SMILES: C(O)C1=NC(=CS1)C2=CC=C(F)C=C2

Synonyms:

• (4-(4-Fluorophenyl)thiazol-2-yl)methanol
• 2-Thiazolemethanol, 4-(4-fluorophenyl)-
• 4-(4-Fluorophenyl)-2-thiazolemethanol

[4-(4-Fluoro-phenyl)-thiazol-2-yl]-methanol

CAS: 1211511-24-8

Versatile small molecule scaffold

Formula: C₁₀H₈FNOS

Purity: Min. 95%

Molecular weight: 209.24 g/mol

Ref: 3D-LYB51124