CAS 1211515-46-6

3-(1H-Pyrazol-4-yl)piperidine

Description:

3-(1H-Pyrazol-4-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a pyrazole moiety. The piperidine ring is a six-membered saturated nitrogen-containing heterocycle, while the pyrazole is a five-membered ring containing two adjacent nitrogen atoms. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, which may contribute to its pharmacological properties. The presence of both nitrogen-containing rings can influence its reactivity and stability, as well as its ability to form hydrogen bonds. Additionally, 3-(1H-Pyrazol-4-yl)piperidine may serve as a scaffold for the development of new therapeutic agents, particularly in the fields of neuroscience and oncology. Overall, its unique combination of functional groups and ring systems makes it a valuable compound for research and development in chemical and pharmaceutical sciences.

Formula: C₈H₁₃N₃

InChI: InChI=1S/C8H13N3/c1-2-7(4-9-3-1)8-5-10-11-6-8/h5-7,9H,1-4H2,(H,10,11)

InChI key: InChIKey=LZQLJAMVAKAJPK-UHFFFAOYSA-N

SMILES: C=1(C=NNC1)C2CCCNC2

Synonyms:

• Piperidine, 3-(1H-pyrazol-4-yl)-
• 3-(1H-Pyrazol-4-yl)piperidine

3-(1H-Pyrazol-4-yl)piperidine

CAS: 1211515-46-6

Versatile small molecule scaffold

Formula: C₈H₁₃N₃

Purity: Min. 95%

Molecular weight: 151.21 g/mol

Ref: 3D-LYB51546