
CAS 1211515-53-5
:2,4-Difluoro-3-pyridinol
Description:
2,4-Difluoro-3-pyridinol is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with two fluorine atoms at the 2 and 4 positions and a hydroxyl group at the 3 position. This compound exhibits polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The fluorine substituents contribute to its unique electronic properties, potentially enhancing its reactivity and stability compared to non-fluorinated analogs. 2,4-Difluoro-3-pyridinol may be utilized in various applications, including pharmaceuticals and agrochemicals, owing to its potential biological activity. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of fluorine can affect the compound's lipophilicity and metabolic stability, which are critical factors in drug design. Overall, 2,4-Difluoro-3-pyridinol represents a valuable compound in the field of organic chemistry with potential implications in various scientific and industrial applications.
Formula:C5H3F2NO
InChI:InChI=1S/C5H3F2NO/c6-3-1-2-8-5(7)4(3)9/h1-2,9H
InChI key:InChIKey=CHNSVRAQNVFBHX-UHFFFAOYSA-N
SMILES:OC=1C(F)=CC=NC1F
Synonyms:- 3-Pyridinol, 2,4-difluoro-
- 2,4-Difluoro-3-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.