
CAS 1211515-77-3
:2-Bromo-3-chloro-6-methoxypyridine
Description:
2-Bromo-3-chloro-6-methoxypyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with bromine, chlorine, and a methoxy group. The bromine atom is located at the 2-position, the chlorine at the 3-position, and the methoxy group at the 6-position of the pyridine ring. This compound is typically a pale yellow to brown solid, exhibiting moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its aromatic nature. The presence of halogen substituents can impart unique reactivity, making it useful in various chemical synthesis applications, particularly in medicinal chemistry and agrochemicals. The methoxy group can influence the electronic properties of the molecule, potentially affecting its biological activity. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of research in drug development. Safety precautions should be observed when handling this compound, as halogenated organic compounds can pose health risks.
Formula:C6H5BrClNO
InChI:InChI=1S/C6H5BrClNO/c1-10-5-3-2-4(8)6(7)9-5/h2-3H,1H3
InChI key:InChIKey=UUXXKGYFVQVDDL-UHFFFAOYSA-N
SMILES:O(C)C=1N=C(Br)C(Cl)=CC1
Synonyms:- 2-Bromo-3-chloro-6-methoxypyridine
- Pyridine, 2-bromo-3-chloro-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.