CAS 1211515-95-5

2-Pyridinecarbonitrile, 3-fluoro-5-methoxy-

Description:

2-Pyridinecarbonitrile, 3-fluoro-5-methoxy- is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a cyano group (-C≡N) at the 2-position of the pyridine ring contributes to its reactivity and potential applications in various chemical syntheses. The 3-fluoro substituent introduces a fluorine atom, which can influence the compound's electronic properties and polarity, potentially enhancing its biological activity or altering its interaction with other molecules. The 5-methoxy group (-OCH3) adds a methoxy functional group, which can affect solubility and reactivity. Overall, this compound may exhibit interesting properties due to the combination of these functional groups, making it of interest in fields such as medicinal chemistry, agrochemicals, or materials science. Its specific applications would depend on further studies into its biological activity and chemical behavior.

Formula: C₇H₅FN₂O

InChI: InChI=1S/C7H5FN2O/c1-11-5-2-6(8)7(3-9)10-4-5/h2,4H,1H3

InChI key: InChIKey=QDHJPLARVISCJF-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(F)C(C#N)=NC1

Synonyms:

• 3-Fluoro-5-methoxypyridine-2-carbonitrile
• 3-Fluoro-5-methoxypicolinonitrile
• 3-Fluoro-5-methoxy-pyridine-2-carbonitrile
• 2-Pyridinecarbonitrile, 3-fluoro-5-methoxy-