CAS 1211516-03-8

2-Methoxy-4-methyl-3-pyridinecarboxylic acid

Description:

2-Methoxy-4-methyl-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) attached to the pyridine ring, as well as a carboxylic acid group (-COOH) that contributes to its acidity. The presence of these functional groups influences its solubility, reactivity, and potential applications in various fields, including pharmaceuticals and agrochemicals. The methoxy group can enhance the compound's lipophilicity, while the carboxylic acid group can participate in hydrogen bonding and ionic interactions. Additionally, the specific arrangement of substituents on the pyridine ring can affect the compound's biological activity and interaction with other molecules. Overall, 2-Methoxy-4-methyl-3-pyridinecarboxylic acid is a versatile compound with potential utility in synthetic chemistry and medicinal applications.

Formula: C₈H₉NO₃

InChI: InChI=1S/C8H9NO3/c1-5-3-4-9-7(12-2)6(5)8(10)11/h3-4H,1-2H3,(H,10,11)

InChI key: InChIKey=JSJYKCPZTCZTII-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OC)N=CC=C1C

Synonyms:

• 3-Pyridinecarboxylic acid, 2-methoxy-4-methyl-
• 2-Methoxy-4-methyl-3-pyridinecarboxylic acid

3-Pyridinecarboxylic acid, 2-methoxy-4-methyl-

CAS: 1211516-03-8

Formula: C₈H₉NO₃

Purity: 95%

Molecular weight: 167.1620

Ref: IN-DA01S6Q2

2-Methoxy-4-methylnicotinic acid

CAS: 1211516-03-8

Purity: ≥95%

Molecular weight: 167.1640015

Ref: 10-F632795

2-Methoxy-4-methylpyridine-3-carboxylic acid

CAS: 1211516-03-8

Versatile small molecule scaffold

Formula: C₈H₉NO₃

Purity: Min. 95%

Molecular weight: 167.16 g/mol

Ref: 3D-LYB51603