
CAS 1211516-10-7
:5H-Cyclopenta[b]pyridine-5-carboxylic acid, 6,7-dihydro-
Description:
5H-Cyclopenta[b]pyridine-5-carboxylic acid, 6,7-dihydro- is a heterocyclic organic compound characterized by its fused ring structure, which includes a pyridine and a cyclopentane moiety. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the dihydro configuration indicates that the compound has two additional hydrogen atoms, which can influence its stability and reactivity. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for various interactions, including hydrogen bonding, which can affect solubility and binding affinity in biological systems. Additionally, the compound's unique structure may lead to specific applications in organic synthesis or as intermediates in the production of more complex molecules. Overall, the characteristics of this compound suggest it may have valuable applications in both research and industry, particularly in fields related to pharmaceuticals and organic synthesis.
Formula:C9H9NO2
InChI:InChI=1S/C9H9NO2/c11-9(12)7-3-4-8-6(7)2-1-5-10-8/h1-2,5,7H,3-4H2,(H,11,12)
InChI key:InChIKey=CXTDAVWPZZKSKG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C=2C(CC1)=NC=CC2
Synonyms:- 5H-Cyclopenta[b]pyridine-5-carboxylic acid, 6,7-dihydro-
- 6,7-Dihydro-5H-cyclopenta[b]pyridine-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.