
CAS 1211517-63-3
:1-[5-(1,1-Dimethylethyl)-3-pyridinyl]ethanone
Description:
1-[5-(1,1-Dimethylethyl)-3-pyridinyl]ethanone, identified by its CAS number 1211517-63-3, is an organic compound characterized by its pyridine ring structure substituted with a tert-butyl group and an ethanone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the pyridine ring suggests that it may participate in various chemical reactions, including electrophilic substitutions and coordination with metal ions. The tert-butyl group enhances its lipophilicity, which can influence its solubility in organic solvents and its biological activity. Additionally, the ethanone moiety may impart ketone-like reactivity, allowing for further functionalization. Overall, this compound's unique structure may render it of interest in fields such as medicinal chemistry, agrochemicals, or materials science, where its specific interactions and properties can be leveraged for various applications.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c1-8(13)9-5-10(7-12-6-9)11(2,3)4/h5-7H,1-4H3
InChI key:InChIKey=CHHGFADFCRHMMI-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1C=C(C(C)=O)C=NC1
Synonyms:- Ethanone, 1-[5-(1,1-dimethylethyl)-3-pyridinyl]-
- 1-[5-(1,1-Dimethylethyl)-3-pyridinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.