CAS 1211518-07-8

Ethyl 4-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate

Description:

Ethyl 4-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a naphthyridine moiety. This compound features a chloro substituent at the 4-position and an ethyl ester functional group at the carboxylic acid position. The presence of the tetrahydro configuration indicates that the compound has a saturated ring system, contributing to its stability and influencing its reactivity. Ethyl 4-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₃ClN₂O₂

InChI: InChI=1S/C11H13ClN2O2/c1-2-16-11(15)8-6-14-9-3-4-13-5-7(9)10(8)12/h6,13H,2-5H2,1H3

InChI key: InChIKey=ZBTURHMNFQHKBN-UHFFFAOYSA-N

SMILES: ClC1=C2C(=NC=C1C(OCC)=O)CCNC2

Synonyms:

• 1,6-Naphthyridine-3-carboxylic acid, 4-chloro-5,6,7,8-tetrahydro-, ethyl ester
• Ethyl 4-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate