CAS 1211518-86-3

4-(2-Aminoethyl)-3-pyridinecarbonitrile

Description:

4-(2-Aminoethyl)-3-pyridinecarbonitrile, identified by its CAS number 1211518-86-3, is an organic compound featuring a pyridine ring substituted with both an aminoethyl group and a cyano group. This compound is characterized by its heterocyclic structure, which contributes to its potential biological activity and chemical reactivity. The presence of the amino group suggests that it can participate in hydrogen bonding and may act as a nucleophile in various chemical reactions. The cyano group, on the other hand, is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This substance may exhibit solubility in polar solvents due to the presence of the amino group, while its pyridine ring may impart some degree of aromatic stability. Overall, 4-(2-Aminoethyl)-3-pyridinecarbonitrile is of interest in medicinal chemistry and material science, where its unique functional groups can be leveraged for the development of pharmaceuticals or other functional materials.

Formula: C₈H₉N₃

InChI: InChI=1S/C8H9N3/c9-3-1-7-2-4-11-6-8(7)5-10/h2,4,6H,1,3,9H2

InChI key: InChIKey=FJEUCFGFJWNOKR-UHFFFAOYSA-N

SMILES: C(CN)C=1C(C#N)=CN=CC1

Synonyms:

• 4-(2-Aminoethyl)-3-pyridinecarbonitrile
• 3-Pyridinecarbonitrile, 4-(2-aminoethyl)-