CAS 1211519-39-9

6-(Difluoromethyl)-2-pyridinemethanamine

Description:

6-(Difluoromethyl)-2-pyridinemethanamine, with the CAS number 1211519-39-9, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a difluoromethyl group (-CF2H) attached to the 6-position of the pyridine, along with an amine group (-NH2) at the 2-position. The presence of the difluoromethyl group imparts unique electronic and steric properties, making it of interest in medicinal chemistry and material science. The amine functionality allows for potential interactions in biological systems, which may contribute to its pharmacological properties. Additionally, the compound's polar nature and the presence of fluorine atoms can influence its solubility and reactivity. Overall, 6-(Difluoromethyl)-2-pyridinemethanamine is a versatile compound that may serve as a building block in the synthesis of more complex molecules or as a potential candidate in drug development.

Formula: C₇H₈F₂N₂

InChI: InChI=1S/C7H8F2N2/c8-7(9)6-3-1-2-5(4-10)11-6/h1-3,7H,4,10H2

InChI key: InChIKey=NUNJVRGXKNYAID-UHFFFAOYSA-N

SMILES: C(F)(F)C=1N=C(CN)C=CC1

Synonyms:

• 6-(Difluoromethyl)-2-pyridinemethanamine
• [6-(Difluoromethyl)pyridin-2-yl]methanamine
• 2-Pyridinemethanamine, 6-(difluoromethyl)-

[6-(Difluoromethyl)pyridin-2-yl]methanamine

CAS: 1211519-39-9

Versatile small molecule scaffold

Formula: C₇H₈F₂N₂

Purity: Min. 95%

Molecular weight: 158.15 g/mol

Ref: 3D-LYB51939