CAS 1211520-37-4

1-(2-Amino-6-chloro-3-pyridinyl)ethanone

Description:

1-(2-Amino-6-chloro-3-pyridinyl)ethanone, with the CAS number 1211520-37-4, is a chemical compound characterized by its pyridine ring structure, which is substituted with an amino group and a chlorine atom. This compound typically exhibits properties associated with both amines and ketones, including potential basicity due to the amino group and reactivity due to the carbonyl functionality. The presence of the chlorine atom can influence its reactivity and solubility in various solvents. It may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, owing to its functional groups. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of biologically active molecules. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for precise applications. Overall, this compound's unique structural features make it of interest in synthetic organic chemistry and medicinal chemistry.

Formula: C₇H₇ClN₂O

InChI: InChI=1S/C7H7ClN2O/c1-4(11)5-2-3-6(8)10-7(5)9/h2-3H,1H3,(H2,9,10)

InChI key: InChIKey=ASXJHAKMJDDWJZ-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(N)N=C(Cl)C=C1

Synonyms:

• 1-(2-Amino-6-chloropyridin-3-yl)ethan-1-one
• Ethanone, 1-(2-amino-6-chloro-3-pyridinyl)-
• 1-(2-Amino-6-chloro-3-pyridinyl)ethanone