CAS 1211520-41-0

4-Bromo-6-chloro-3-pyridinol

Description:

4-Bromo-6-chloro-3-pyridinol is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 4 and 6 positions with bromine and chlorine atoms, respectively, and has a hydroxyl group at the 3 position. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. Its molecular structure contributes to its potential reactivity, making it of interest in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. The presence of halogen substituents can influence its biological activity and stability. Additionally, 4-Bromo-6-chloro-3-pyridinol may exhibit properties such as antimicrobial or herbicidal activity, depending on the context of its use. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose health risks. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₅H₃BrClNO

InChI: InChI=1S/C5H3BrClNO/c6-3-1-5(7)8-2-4(3)9/h1-2,9H

InChI key: InChIKey=RDVSUXPUQWXZFG-UHFFFAOYSA-N

SMILES: BrC=1C(O)=CN=C(Cl)C1

Synonyms:

• 3-Pyridinol, 4-bromo-6-chloro-
• 4-Bromo-6-chloro-3-pyridinol