CAS 1211520-56-7

3-Ethynyl-5-(trifluoromethyl)pyridine

Description:

3-Ethynyl-5-(trifluoromethyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an ethynyl group at the 3-position introduces a triple bond, contributing to its reactivity and potential applications in organic synthesis. The trifluoromethyl group at the 5-position enhances the compound's electron-withdrawing properties, which can influence its chemical behavior and interactions with other molecules. This compound is typically colorless to pale yellow and may be used in various chemical reactions, including cross-coupling reactions and as a building block in the synthesis of pharmaceuticals and agrochemicals. Its unique structure allows for potential applications in materials science and medicinal chemistry, particularly in the development of compounds with specific biological activities. As with many fluorinated compounds, it may exhibit increased stability and lipophilicity, making it of interest in drug design and development. Safety data should be consulted for handling and usage, as fluorinated compounds can have specific environmental and health considerations.

Formula: C₈H₄F₃N

InChI: InChI=1S/C8H4F3N/c1-2-6-3-7(5-12-4-6)8(9,10)11/h1,3-5H

InChI key: InChIKey=PNIPWJXORLTRCA-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C#C)C=NC1

Synonyms:

• Pyridine, 3-ethynyl-5-(trifluoromethyl)-
• 3-Ethynyl-5-(trifluoromethyl)pyridine