CAS 1211520-57-8

4-Chloro-1H-pyrazolo[3,4-b]pyridin-3-amine

Description:

4-Chloro-1H-pyrazolo[3,4-b]pyridin-3-amine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both pyrazole and pyridine rings. This compound features a chlorine atom at the 4-position of the pyrazole ring and an amino group at the 3-position, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may interact with various biological targets. Its molecular structure allows for the possibility of forming hydrogen bonds, which can influence its pharmacokinetic properties. Additionally, the presence of the chlorine substituent can enhance lipophilicity and affect the compound's overall stability and reactivity. As with many heterocycles, it may also exhibit unique electronic properties, making it a subject of interest in materials science and organic synthesis.

Formula: C₆H₅ClN₄

InChI: InChI=1S/C6H5ClN4/c7-3-1-2-9-6-4(3)5(8)10-11-6/h1-2H,(H3,8,9,10,11)

InChI key: InChIKey=WLEFOJZUNXANLB-UHFFFAOYSA-N

SMILES: ClC1=C2C(=NC=C1)NN=C2N

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridin-3-amine, 4-chloro-
• 4-Chloro-1H-pyrazolo[3,4-b]pyridin-3-amine