CymitQuimica logo

CAS 1211521-35-5

:

2-Bromo-3-(1,1-dimethylethyl)pyridine

Description:
2-Bromo-3-(1,1-dimethylethyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a bulky tert-butyl group at the 3-position significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The bromine substituent can participate in nucleophilic substitution reactions, while the tert-butyl group can provide steric hindrance, affecting the compound's reactivity. Additionally, the nitrogen atom in the pyridine ring can engage in coordination with metal ions, making it useful in coordination chemistry. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-Bromo-3-(1,1-dimethylethyl)pyridine is a versatile compound with significant implications in various chemical applications.
Formula:C9H12BrN
InChI:InChI=1S/C9H12BrN/c1-9(2,3)7-5-4-6-11-8(7)10/h4-6H,1-3H3
InChI key:InChIKey=GNKSIAKAPOWLMH-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(Br)N=CC=C1
Synonyms:
  • Pyridine, 2-bromo-3-(1,1-dimethylethyl)-
  • 2-Bromo-3-(1,1-dimethylethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.