CAS 1211522-15-4

Pyrimidine, 2-chloro-5-(4-pyridinyl)-

Description:

Pyrimidine, 2-chloro-5-(4-pyridinyl)- is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom and a pyridine moiety. The presence of the chlorine atom at the 2-position and the 4-pyridinyl group at the 5-position contributes to its unique chemical properties, including potential reactivity and biological activity. This compound is typically a colorless to pale yellow solid, and its molecular structure allows for various interactions, making it of interest in medicinal chemistry and material science. Pyrimidines are known for their role in nucleic acids, and derivatives like this one may exhibit pharmacological properties, including antimicrobial or anticancer activities. The compound's solubility and stability can vary depending on the solvent and environmental conditions. Additionally, its synthesis often involves standard organic reactions such as halogenation and coupling reactions. Overall, 2-chloro-5-(4-pyridinyl)pyrimidine represents a versatile scaffold for further chemical modifications and applications in drug development.

Formula: C₉H₆ClN₃

InChI: InChI=1S/C9H6ClN3/c10-9-12-5-8(6-13-9)7-1-3-11-4-2-7/h1-6H

InChI key: InChIKey=BTHXIKXWLGJYPU-UHFFFAOYSA-N

SMILES: ClC=1N=CC(=CN1)C=2C=CN=CC2

Synonyms:

• Pyrimidine, 2-chloro-5-(4-pyridinyl)-
• 2-Chloro-5-(pyridin-4-yl)pyrimidine