
CAS 1211523-06-6
:3-Pyridinecarbonitrile, 2-acetyl-
Description:
3-Pyridinecarbonitrile, 2-acetyl- is an organic compound characterized by the presence of a pyridine ring, a cyano group, and an acetyl functional group. Its molecular structure features a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for forming coordination complexes. The cyano group (-C≡N) is known for its strong electron-withdrawing properties, which can influence the reactivity and polarity of the compound. The acetyl group (-COCH₃) adds to the compound's reactivity, making it a potential precursor for various synthetic pathways. This compound may exhibit properties typical of both aromatic and aliphatic systems, such as solubility in polar solvents and potential interactions with nucleophiles due to the electrophilic nature of the carbonyl carbon in the acetyl group. Its applications may span across pharmaceuticals, agrochemicals, and materials science, where it could serve as an intermediate in the synthesis of more complex molecules.
Formula:C8H6N2O
InChI:InChI=1S/C8H6N2O/c1-6(11)8-7(5-9)3-2-4-10-8/h2-4H,1H3
InChI key:InChIKey=QUNYQZWKUVQOQF-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C(C)=O)N=CC=C1
Synonyms:- 3-Pyridinecarbonitrile, 2-acetyl-
- 2-Acetylpyridine-3-carbonitrile
- 1-(3-Cyanopyridin-2-yl)ethan-1-one
- 2-Acetylnicotinonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.