CymitQuimica logo

CAS 1211523-07-7

:

6,7-Dihydro-3-hydroxy-5H-cyclopenta[b]pyridin-5-one

Description:
6,7-Dihydro-3-hydroxy-5H-cyclopenta[b]pyridin-5-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine ring fused to a cyclopentane moiety. This compound features a hydroxyl group (-OH) at the 3-position and a carbonyl group (C=O) at the 5-position, contributing to its reactivity and potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its interaction with biological targets. The compound's molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to various bioactive molecules. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics (NMR, IR, etc.), would be essential for its identification and characterization in laboratory settings. Overall, 6,7-Dihydro-3-hydroxy-5H-cyclopenta[b]pyridin-5-one represents a significant structure for further research in organic and medicinal chemistry.
Formula:C8H7NO2
InChI:InChI=1S/C8H7NO2/c10-5-3-6-7(9-4-5)1-2-8(6)11/h3-4,10H,1-2H2
InChI key:InChIKey=OSOILDJSFKHWAT-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC=C(O)C2)CC1
Synonyms:
  • 6,7-Dihydro-3-hydroxy-5H-cyclopenta[b]pyridin-5-one
  • 5H-Cyclopenta[b]pyridin-5-one, 6,7-dihydro-3-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.