CymitQuimica logo

CAS 1211523-96-4

:

2-(5-Bromo-3-pyridinyl)morpholine

Description:
2-(5-Bromo-3-pyridinyl)morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a pyridine moiety substituted with a bromine atom. The presence of the bromine atom at the 5-position of the pyridine ring enhances its reactivity and can influence its biological activity. This compound is typically a solid at room temperature and is soluble in polar organic solvents, which is common for many nitrogen-containing heterocycles. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the morpholine and pyridine functionalities, which are known to interact with biological targets. Additionally, the compound may exhibit interesting properties such as antimicrobial or anticancer activities, although specific biological data would be required to confirm these effects. Safety data should be consulted to understand its handling and toxicity, as halogenated compounds can sometimes pose environmental and health risks.
Formula:C9H11BrN2O
InChI:InChI=1S/C9H11BrN2O/c10-8-3-7(4-12-5-8)9-6-11-1-2-13-9/h3-5,9,11H,1-2,6H2
InChI key:InChIKey=NLPNISKHBHOVIL-UHFFFAOYSA-N
SMILES:BrC1=CC(=CN=C1)C2CNCCO2
Synonyms:
  • Morpholine, 2-(5-bromo-3-pyridinyl)-
  • 2-(5-Bromo-3-pyridinyl)morpholine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.