CymitQuimica logo

CAS 1211524-11-6

:

5,6,7,8-Tetrahydrotetrazolo[1,5-a]pyridine-8-carboxylic acid

Description:
5,6,7,8-Tetrahydrotetrazolo[1,5-a]pyridine-8-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which includes a tetrazole ring fused to a pyridine ring. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential for forming salts or esters. The presence of the tetrahydro configuration indicates that the compound is saturated, which can influence its reactivity and stability. It is typically soluble in polar solvents due to the carboxylic acid group, making it amenable for various chemical reactions and applications in medicinal chemistry. The compound may exhibit biological activity, potentially serving as a scaffold for drug development, particularly in the context of neuropharmacology or as a building block in the synthesis of more complex molecules. Its specific interactions and applications would depend on further studies, including its pharmacokinetics and pharmacodynamics. Overall, 5,6,7,8-Tetrahydrotetrazolo[1,5-a]pyridine-8-carboxylic acid represents a versatile compound of interest in both synthetic and medicinal chemistry.
Formula:C6H8N4O2
InChI:InChI=1S/C6H8N4O2/c11-6(12)4-2-1-3-10-5(4)7-8-9-10/h4H,1-3H2,(H,11,12)
InChI key:InChIKey=FGJXNIPCKWVFPJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C=2N(N=NN2)CCC1
Synonyms:
  • Tetrazolo[1,5-a]pyridine-8-carboxylic acid, 5,6,7,8-tetrahydro-
  • 5,6,7,8-Tetrahydrotetrazolo[1,5-a]pyridine-8-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.