CAS 1211524-39-8

4-Fluoro-2-thiazolecarboxylic acid

Description:

4-Fluoro-2-thiazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a carboxylic acid functional group (-COOH) and a fluorine atom at the 4-position of the thiazole ring, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. The presence of the fluorine atom can enhance the compound's reactivity and influence its biological activity, making it of interest in pharmaceutical research. Additionally, the thiazole moiety is known for its role in various biological activities, including antimicrobial and antifungal properties. As with many thiazole derivatives, 4-Fluoro-2-thiazolecarboxylic acid may serve as a building block in the synthesis of more complex molecules or as a potential lead compound in drug development. Safety and handling precautions should be observed due to the potential reactivity of the compound.

Formula: C₄H₂FNO₂S

InChI: InChI=1S/C4H2FNO2S/c5-2-1-9-3(6-2)4(7)8/h1H,(H,7,8)

InChI key: InChIKey=JMIBOPXVBJETBU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NC(F)=CS1

Synonyms:

• 2-Thiazolecarboxylic acid, 4-fluoro-
• 4-Fluoro-2-thiazolecarboxylic acid