CAS 1211524-68-3

3-(1,1-Dimethylethyl)-2-pyridinemethanamine

Description:

3-(1,1-Dimethylethyl)-2-pyridinemethanamine, identified by its CAS number 1211524-68-3, is an organic compound characterized by a pyridine ring substituted with an amine group and a tert-butyl group. The presence of the pyridine moiety imparts basic properties to the compound, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The tert-butyl group enhances the steric bulk around the amine, which can influence its reactivity and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. Its structural features suggest potential applications in medicinal chemistry, where modifications to the amine or pyridine ring could lead to derivatives with enhanced efficacy or selectivity. Overall, the unique combination of functional groups in 3-(1,1-Dimethylethyl)-2-pyridinemethanamine contributes to its potential utility in various chemical and biological contexts.

Formula: C₁₀H₁₆N₂

InChI: InChI=1S/C10H16N2/c1-10(2,3)8-5-4-6-12-9(8)7-11/h4-6H,7,11H2,1-3H3

InChI key: InChIKey=GGKPYUOAMFEYCY-UHFFFAOYSA-N

SMILES: C(N)C1=C(C(C)(C)C)C=CC=N1

Synonyms:

• 2-Pyridinemethanamine, 3-(1,1-dimethylethyl)-
• (3-tert-Butylpyridin-2-yl)methanamine
• 2-(Aminomethyl)-3-tert-butylpyridine
• 3-(1,1-Dimethylethyl)-2-pyridinemethanamine