CymitQuimica logo

CAS 1211525-30-2

:

5-(2-Pyrrolidinyl)-1,2,4-oxadiazole

Description:
5-(2-Pyrrolidinyl)-1,2,4-oxadiazole is a heterocyclic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and one oxygen atom within a five-membered ring structure. The compound features a pyrrolidine moiety, a five-membered saturated nitrogen-containing ring, which contributes to its unique chemical properties. This substance is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The oxadiazole ring is known for its stability and ability to participate in various chemical reactions, making it a valuable scaffold in drug design. Additionally, the presence of the pyrrolidine group may enhance the compound's solubility and bioavailability. Overall, 5-(2-Pyrrolidinyl)-1,2,4-oxadiazole represents a class of compounds that may exhibit interesting biological activities, warranting further investigation in the fields of organic and medicinal chemistry.
Formula:C6H9N3O
InChI:InChI=1S/C6H9N3O/c1-2-5(7-3-1)6-8-4-9-10-6/h4-5,7H,1-3H2
InChI key:InChIKey=ANLVMPLXUXEQBJ-UHFFFAOYSA-N
SMILES:C1(CCCN1)C2=NC=NO2
Synonyms:
  • 1,2,4-Oxadiazole, 5-(2-pyrrolidinyl)-
  • 5-(2-Pyrrolidinyl)-1,2,4-oxadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.