CymitQuimica logo

CAS 1211525-35-7

:

5-Bromofuro[2,3-d]pyrimidin-4-amine

Description:
5-Bromofuro[2,3-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its fused ring structure, which includes a pyrimidine and a furan moiety. The presence of a bromine atom at the 5-position of the furo[2,3-d]pyrimidine framework contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the presence of the amine functional group. Its structural features suggest potential biological activity, making it a candidate for further investigation in drug development. The compound's molecular interactions can be influenced by the bromine substituent, which may affect its pharmacokinetic properties. As with many heterocycles, it may also exhibit fluorescence or other optical properties, depending on its environment. Overall, 5-Bromofuro[2,3-d]pyrimidin-4-amine represents a versatile scaffold for the synthesis of more complex molecules in the field of organic and medicinal chemistry.
Formula:C6H4BrN3O
InChI:InChI=1S/C6H4BrN3O/c7-3-1-11-6-4(3)5(8)9-2-10-6/h1-2H,(H2,8,9,10)
InChI key:InChIKey=UWXSLPNUDZRXII-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=N1)OC=C2Br
Synonyms:
  • Furo[2,3-d]pyrimidin-4-amine, 5-bromo-
  • 5-Bromofuro[2,3-d]pyrimidin-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.