CAS 1211525-93-7
:2-Bromo-3-methyl-6-(trifluoromethyl)pyridine
Description:
2-Bromo-3-methyl-6-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 2-position, a methyl group at the 3-position, and a trifluoromethyl group at the 6-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits moderate polarity due to the electronegative bromine and trifluoromethyl groups, which can influence its reactivity and solubility in various solvents. The trifluoromethyl group is known for imparting significant lipophilicity and can enhance the compound's biological activity. 2-Bromo-3-methyl-6-(trifluoromethyl)pyridine is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its reactivity can be attributed to the presence of the bromine atom, which can participate in nucleophilic substitution reactions, making it a valuable intermediate in various chemical transformations.
Formula:C7H5BrF3N
InChI:InChI=1S/C7H5BrF3N/c1-4-2-3-5(7(9,10)11)12-6(4)8/h2-3H,1H3
InChI key:InChIKey=NFVHXFGHHXWEMO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(Br)C(C)=CC1
Synonyms:- Pyridine, 2-bromo-3-methyl-6-(trifluoromethyl)-
- 2-Bromo-3-methyl-6-(trifluoromethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
