
CAS 1211527-21-7
:7-Chloro-1H-indazol-4-amine
Description:
7-Chloro-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 7-position and an amino group at the 4-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its interactions with biological macromolecules. Additionally, the chlorine substituent can affect the compound's lipophilicity and overall pharmacokinetic properties. As with many indazole derivatives, 7-Chloro-1H-indazol-4-amine may exhibit interesting pharmacological activities, making it a subject of interest in drug discovery and development.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c8-5-1-2-6(9)4-3-10-11-7(4)5/h1-3H,9H2,(H,10,11)
InChI key:InChIKey=VIOIOZHPRWRJGG-UHFFFAOYSA-N
SMILES:NC1=C2C(=C(Cl)C=C1)NN=C2
Synonyms:- 7-Chloro-1H-indazol-4-amine
- 1H-Indazol-4-amine, 7-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.