CAS 1211527-22-8

2-Chloro-6-methyl-4-pyridinesulfonyl chloride

Description:

2-Chloro-6-methyl-4-pyridinesulfonyl chloride is a chemical compound characterized by its pyridine ring structure, which is substituted with a chlorine atom and a sulfonyl chloride group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions. It is often used in organic synthesis, particularly in the preparation of sulfonamide derivatives and other complex molecules. The chlorine atom at the 2-position and the methyl group at the 6-position contribute to its unique reactivity and potential applications in medicinal chemistry. Safety precautions are essential when handling this compound, as it can be corrosive and may pose health risks if inhaled or in contact with skin. Proper storage and disposal methods should be followed to mitigate any environmental impact.

Formula: C₆H₅Cl₂NO₂S

InChI: InChI=1S/C6H5Cl2NO2S/c1-4-2-5(12(8,10)11)3-6(7)9-4/h2-3H,1H3

InChI key: InChIKey=MXQTXQJLWCLANT-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=C(C)N=C(Cl)C1

Synonyms:

• 2-Chloro-6-methyl-4-pyridinesulfonyl chloride
• 4-Pyridinesulfonyl chloride, 2-chloro-6-methyl-