CymitQuimica logo

CAS 1211527-36-4

:

2-(5-Nitro-2-pyridinyl)morpholine

Description:
2-(5-Nitro-2-pyridinyl)morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a nitro-substituted pyridine moiety. The presence of the nitro group typically imparts significant polarity and can influence the compound's reactivity and solubility in various solvents. This compound is often studied for its potential biological activities, particularly in medicinal chemistry, where modifications to the pyridine and morpholine components can lead to compounds with desirable pharmacological properties. The morpholine ring contributes to the compound's basicity and can participate in hydrogen bonding, which may enhance its interactions with biological targets. Additionally, the nitro group can serve as a site for further chemical modifications, making it a versatile building block in organic synthesis. Overall, 2-(5-Nitro-2-pyridinyl)morpholine is of interest in research contexts, particularly in the development of new therapeutic agents.
Formula:C9H11N3O3
InChI:InChI=1S/C9H11N3O3/c13-12(14)7-1-2-8(11-5-7)9-6-10-3-4-15-9/h1-2,5,9-10H,3-4,6H2
InChI key:InChIKey=MULJGACRYQJQJE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(N=C1)C2CNCCO2
Synonyms:
  • 2-(5-Nitro-2-pyridinyl)morpholine
  • Morpholine, 2-(5-nitro-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.