CymitQuimica logo

CAS 1211528-27-6

:

2-Cyclopropyl-4-pyridinecarboxaldehyde

Description:
2-Cyclopropyl-4-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a cyclopropyl group, a three-membered carbon ring, contributes to its unique structural properties and reactivity. This compound features an aldehyde functional group (-CHO) attached to the pyridine ring, which is known for its reactivity in various chemical reactions, including nucleophilic additions and condensation reactions. The molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals due to the biological activity often associated with pyridine derivatives. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by the presence of both the cyclopropyl and aldehyde groups, making it an interesting subject for further study in terms of its chemical behavior and potential applications. As with many organic compounds, safety and handling precautions should be observed due to the potential hazards associated with its reactivity and toxicity.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c11-6-7-3-4-10-9(5-7)8-1-2-8/h3-6,8H,1-2H2
InChI key:InChIKey=XIMBNXYJJWSYCA-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C2CC2)N=CC1
Synonyms:
  • 2-Cyclopropyl-4-pyridinecarboxaldehyde
  • 4-Pyridinecarboxaldehyde, 2-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.