CymitQuimica logo

CAS 1211528-98-1

:

3-(1,2,4-Oxadiazol-5-yl)piperidine

Description:
3-(1,2,4-Oxadiazol-5-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a 1,2,4-oxadiazole moiety. The piperidine portion contributes to its cyclic amine properties, making it a potential candidate for various biological activities, including its role as a pharmacophore in medicinal chemistry. The oxadiazole ring is known for its heterocyclic nature, which can impart specific electronic and steric properties, enhancing the compound's reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, including antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would depend on empirical studies. Additionally, its solubility, stability, and reactivity can be influenced by the functional groups present and the overall molecular geometry. As with many heterocyclic compounds, the synthesis and characterization of 3-(1,2,4-Oxadiazol-5-yl)piperidine are crucial for understanding its potential applications in drug development and other fields of chemistry.
Formula:C7H11N3O
InChI:InChI=1S/C7H11N3O/c1-2-6(4-8-3-1)7-9-5-10-11-7/h5-6,8H,1-4H2
InChI key:InChIKey=LFGAVXRHHARQKL-UHFFFAOYSA-N
SMILES:C1(=NC=NO1)C2CCCNC2
Synonyms:
  • 3-(1,2,4-Oxadiazol-5-yl)piperidine
  • Piperidine, 3-(1,2,4-oxadiazol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.