
CAS 1211529-03-1
:2-(2-Oxazolyl)benzenemethanamine
Description:
2-(2-Oxazolyl)benzenemethanamine, identified by its CAS number 1211529-03-1, is a chemical compound characterized by the presence of both an oxazole ring and a benzene ring in its structure. The oxazole moiety contributes to its potential biological activity, as oxazoles are known for their roles in various pharmacological applications. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water, which is common for many aromatic amines. The presence of the amine functional group suggests that it may engage in hydrogen bonding, influencing its reactivity and interaction with other molecules. Additionally, the compound's structure may impart specific electronic properties, making it a candidate for studies in medicinal chemistry or material science. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in the development of new pharmaceuticals or agrochemicals. As with any chemical substance, safety data and handling precautions should be reviewed before use.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c11-7-8-3-1-2-4-9(8)10-12-5-6-13-10/h1-6H,7,11H2
InChI key:InChIKey=FXIIJLSVCDPHPZ-UHFFFAOYSA-N
SMILES:C(N)C1=C(C=CC=C1)C2=NC=CO2
Synonyms:- Benzenemethanamine, 2-(2-oxazolyl)-
- 2-(2-Oxazolyl)benzenemethanamine
- [2-(1,3-Oxazol-2-yl)phenyl]methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.