
CAS 1211530-06-1
:2-Amino-1-(5-pyrimidinyl)ethanone
Description:
2-Amino-1-(5-pyrimidinyl)ethanone, identified by its CAS number 1211530-06-1, is an organic compound characterized by the presence of an amino group and a pyrimidine ring. This substance features a ketone functional group adjacent to the amino group, which contributes to its reactivity and potential biological activity. The pyrimidine moiety, a six-membered aromatic ring containing two nitrogen atoms, is known for its role in various biological systems, including nucleic acids. The compound may exhibit properties such as solubility in polar solvents, and its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of both amino and carbonyl functionalities allows for various chemical reactions, including nucleophilic additions and substitutions. Overall, 2-Amino-1-(5-pyrimidinyl)ethanone is a compound that may have applications in pharmaceuticals or as a building block in organic synthesis, although specific biological activities and applications would require further investigation.
Formula:C6H7N3O
InChI:InChI=1S/C6H7N3O/c7-1-6(10)5-2-8-4-9-3-5/h2-4H,1,7H2
InChI key:InChIKey=NLIRJUBUHBPQME-UHFFFAOYSA-N
SMILES:C(CN)(=O)C=1C=NC=NC1
Synonyms:- 2-Amino-1-(5-pyrimidinyl)ethanone
- Ethanone, 2-amino-1-(5-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.