CymitQuimica logo

CAS 1211530-26-5

:

5-(1,1-Difluoroethyl)-3-pyridinecarboxylic acid

Description:
5-(1,1-Difluoroethyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The difluoroethyl substituent introduces significant electronegativity due to the fluorine atoms, which can influence the compound's reactivity and polarity. This compound may exhibit unique properties such as increased lipophilicity and altered solubility compared to its non-fluorinated counterparts. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the pyridine ring can enhance biological activity. Additionally, the presence of fluorine atoms often contributes to improved metabolic stability and bioavailability. Overall, 5-(1,1-Difluoroethyl)-3-pyridinecarboxylic acid is a compound of interest in various chemical and pharmaceutical research contexts.
Formula:C8H7F2NO2
InChI:InChI=1S/C8H7F2NO2/c1-8(9,10)6-2-5(7(12)13)3-11-4-6/h2-4H,1H3,(H,12,13)
InChI key:InChIKey=VTOXZHIQYFUZCW-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C=1C=C(C(O)=O)C=NC1
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-(1,1-difluoroethyl)-
  • 5-(1,1-Difluoroethyl)-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.